Chalcogenation of 1,3-dichloropropene with elemental chalcogens in the system hydrazine hydrate–base

Resumo

Sulfur reacts with 1,3-dichloropropene in the system hydrazine hydrate–KOH to form bis(1-chloroprop-1-en-3-yl) sulfide, and in the system hydrazine hydrate–monoethanolamine, bis(1-chloroprop-1-en- 3-yl) disulfide. The reaction of tellurium in the system hydrazine hydrate–KOH leads to diallyl telluride, the product of nucleophilic substitution of the allylic chlorine atom and reductive cleavage of the С_sp2–Cl bond. The reaction of selenium with 1,3-dichloropropene gives a complex mixture of products. At excess KOH (Se: KOH = 1: 5) bis(1-chloroprop-1-en-3-yl) selenide was isolated.